C24H26N4O2 — CID 123493088
7-(1,4-diazepan-1-yl)-3-(7-methyl-7,8-dihydroimidazo[1,2-a]azocin-2-yl)chromen-2-one (PubChem CID 123493088) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 7-(1,4-diazepan-1-yl)-3-(7-methyl-7,8-dihydroimidazo[1,2-a]azocin-2-yl)chromen-2-one.
| Compound Name | 7-(1,4-diazepan-1-yl)-3-(7-methyl-7,8-dihydroimidazo[1,2-a]azocin-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 123493088 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 7-(1,4-diazepan-1-yl)-3-(7-methyl-7,8-dihydroimidazo[1,2-a]azocin-2-yl)chromen-2-one |
| SMILES | CC1C=Cn2cc(-c3cc4ccc(N5CCCNCC5)cc4oc3=O)nc2C=CC1 |
| InChI | InChI=1S/C24H26N4O2/c1-17-4-2-5-23-26-21(16-28(23)12-8-17)20-14-18-6-7-19(15-22(18)30-24(20)29)27-11-3-9-25-10-13-27/h2,5-8,12,14-17,25H,3-4,9-11,13H2,1H3 |
| InChIKey | HHJXGHMTIYNNBU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|