C14H23NO9S2 — CID 123603449
2-methyl-3-(2-methylprop-2-enoyloxy)-2-(prop-2-enoylamino)hexane-1,4-disulfonic acid (PubChem CID 123603449) has the molecular formula C14H23NO9S2 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-methyl-3-(2-methylprop-2-enoyloxy)-2-(prop-2-enoylamino)hexane-1,4-disulfonic acid.
| Compound Name | 2-methyl-3-(2-methylprop-2-enoyloxy)-2-(prop-2-enoylamino)hexane-1,4-disulfonic acid |
|---|---|
| PubChem CID | 123603449 |
| Molecular Formula | C14H23NO9S2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-methyl-3-(2-methylprop-2-enoyloxy)-2-(prop-2-enoylamino)hexane-1,4-disulfonic acid |
| SMILES | C=CC(=O)NC(C)(CS(=O)(=O)O)C(OC(=O)C(=C)C)C(CC)S(=O)(=O)O |
| InChI | InChI=1S/C14H23NO9S2/c1-6-10(26(21,22)23)12(24-13(17)9(3)4)14(5,8-25(18,19)20)15-11(16)7-2/h7,10,12H,2-3,6,8H2,1,4-5H3,(H,15,16)(H,18,19,20)(H,21,22,23) |
| InChIKey | PBFIPBBMJKWLFG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|