C25H27N5O5S — CID 123682197
2-[[amino-[[2-(4-hydroxyphenyl)acetyl]amino]methylidene]amino]-3-phenyl-N-[(4-sulfamoylphenyl)methyl]propanamide (PubChem CID 123682197) has the molecular formula C25H27N5O5S and a molecular weight of 509.59 g/mol. Its IUPAC name is 2-[[amino-[[2-(4-hydroxyphenyl)acetyl]amino]methylidene]amino]-3-phenyl-N-[(4-sulfamoylphenyl)methyl]propanamide.
| Compound Name | 2-[[amino-[[2-(4-hydroxyphenyl)acetyl]amino]methylidene]amino]-3-phenyl-N-[(4-sulfamoylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 123682197 |
| Molecular Formula | C25H27N5O5S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-[[amino-[[2-(4-hydroxyphenyl)acetyl]amino]methylidene]amino]-3-phenyl-N-[(4-sulfamoylphenyl)methyl]propanamide |
| SMILES | N/C(=N\C(Cc1ccccc1)C(=O)NCc1ccc(S(N)(=O)=O)cc1)NC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C25H27N5O5S/c26-25(30-23(32)15-18-6-10-20(31)11-7-18)29-22(14-17-4-2-1-3-5-17)24(33)28-16-19-8-12-21(13-9-19)36(27,34)35/h1-13,22,31H,14-16H2,(H,28,33)(H2,27,34,35)(H3,26,29,30,32) |
| InChIKey | QXRJITPHSVQTHT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|