C21H24O5 — CID 123706822
(1R,2S,6R,7S)-1-(1,3-dioxolan-2-yl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123706822) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1-(1,3-dioxolan-2-yl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-1-(1,3-dioxolan-2-yl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123706822 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1R,2S,6R,7S)-1-(1,3-dioxolan-2-yl)-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cc(C)c(C2C(=O)[C@H]3[C@@H]4CC[C@@](C5OCCO5)(O4)[C@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C21H24O5/c1-10-8-11(2)14(12(3)9-10)16-18(22)15-13-4-5-21(26-13,17(15)19(16)23)20-24-6-7-25-20/h8-9,13,15-17,20H,4-7H2,1-3H3/t13-,15-,16?,17+,21+/m0/s1 |
| InChIKey | KUNFOXGGPRUKIT-AKIMDFQFSA-N |
| XLogP | 2.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|