C22H34NPS+2 — CID 123821546
(5,5-diethyl-4-methyl-4-propylthieno[2,3-a]quinolizin-6-ium-2-yl)-trimethylphosphanium (PubChem CID 123821546) has the molecular formula C22H34NPS+2 and a molecular weight of 375.56 g/mol. Its IUPAC name is (5,5-diethyl-4-methyl-4-propylthieno[2,3-a]quinolizin-6-ium-2-yl)-trimethylphosphanium.
| Compound Name | (5,5-diethyl-4-methyl-4-propylthieno[2,3-a]quinolizin-6-ium-2-yl)-trimethylphosphanium |
|---|---|
| PubChem CID | 123821546 |
| Molecular Formula | C22H34NPS+2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (5,5-diethyl-4-methyl-4-propylthieno[2,3-a]quinolizin-6-ium-2-yl)-trimethylphosphanium |
| SMILES | CCCC1(C)c2cc([P+](C)(C)C)sc2-c2cccc[n+]2C1(CC)CC |
| InChI | InChI=1S/C22H34NPS/c1-8-14-21(4)17-16-19(24(5,6)7)25-20(17)18-13-11-12-15-23(18)22(21,9-2)10-3/h11-13,15-16H,8-10,14H2,1-7H3/q+2 |
| InChIKey | FVSQCEAGJJTSRU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|