C30H38F2N5O9P — CID 123971905
cyclohexyl 2-[[[(2S,3S,4S,5S)-5-(4-ethoxy-2-formamido-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2,3-difluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 123971905) has the molecular formula C30H38F2N5O9P and a molecular weight of 681.63 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2S,3S,4S,5S)-5-(4-ethoxy-2-formamido-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2,3-difluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(2S,3S,4S,5S)-5-(4-ethoxy-2-formamido-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2,3-difluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123971905 |
| Molecular Formula | C30H38F2N5O9P |
| Molecular Weight | 681.63 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | cyclohexyl 2-[[[(2S,3S,4S,5S)-5-(4-ethoxy-2-formamido-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2,3-difluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(NC=O)nc2c([C@@H]3O[C@](F)(COP(=O)(NC(C)C(=O)OC4CCCCC4)Oc4ccccc4)[C@@H](F)[C@@]3(C)O)c[nH]c12 |
| InChI | InChI=1S/C30H38F2N5O9P/c1-4-42-25-23-22(35-28(36-25)34-17-38)21(15-33-23)24-29(3,40)27(31)30(32,45-24)16-43-47(41,46-20-13-9-6-10-14-20)37-18(2)26(39)44-19-11-7-5-8-12-19/h6,9-10,13-15,17-19,24,27,33,40H,4-5,7-8,11-12,16H2,1-3H3,(H,37,41)(H,34,35,36,38)/t18?,24-,27-,29-,30+,47?/m0/s1 |
| InChIKey | ZEQOJFIWTMZLON-HXMABTSGSA-N |
| XLogP | 4.81 |
| TPSA | 183.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|