C19H23N5O3 — CID 123982860
N'-[(1R,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylamino)pyridine-3-carbohydrazide (PubChem CID 123982860) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N'-[(1R,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylamino)pyridine-3-carbohydrazide.
| Compound Name | N'-[(1R,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylamino)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 123982860 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N'-[(1R,2S)-2-aminocyclohexyl]-2-(1,3-benzodioxol-5-ylamino)pyridine-3-carbohydrazide |
| SMILES | N[C@H]1CCCC[C@H]1NNC(=O)c1cccnc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H23N5O3/c20-14-5-1-2-6-15(14)23-24-19(25)13-4-3-9-21-18(13)22-12-7-8-16-17(10-12)27-11-26-16/h3-4,7-10,14-15,23H,1-2,5-6,11,20H2,(H,21,22)(H,24,25)/t14-,15+/m0/s1 |
| InChIKey | HFGBFZUGWNRWGP-LSDHHAIUSA-N |
| XLogP | 2.06 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|