C22H18BrCl2N3O6S — CID 126343076
N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 126343076) has the molecular formula C22H18BrCl2N3O6S and a molecular weight of 603.28 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 126343076 |
| Molecular Formula | C22H18BrCl2N3O6S |
| Molecular Weight | 603.28 g/mol |
| Exact Mass | 600.95 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | COc1cc(/C=N\NS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H18BrCl2N3O6S/c1-13-3-6-17(10-20(13)28(29)30)35(31,32)27-26-11-14-7-18(23)22(21(8-14)33-2)34-12-15-4-5-16(24)9-19(15)25/h3-11,27H,12H2,1-2H3/b26-11- |
| InChIKey | RAUMPDNTMKSCAH-RAWMCFOBSA-N |
| XLogP | 5.87 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.28 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|