C5H4N8O4 — CID 12649247
5-methyl-3-nitro-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole (PubChem CID 12649247) has the molecular formula C5H4N8O4 and a molecular weight of 240.14 g/mol. Its IUPAC name is 5-methyl-3-nitro-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole.
| Compound Name | 5-methyl-3-nitro-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 12649247 |
| Molecular Formula | C5H4N8O4 |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 5-methyl-3-nitro-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole |
| SMILES | Cc1nc([N+](=O)[O-])nn1-c1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C5H4N8O4/c1-2-6-5(13(16)17)10-11(2)3-7-4(9-8-3)12(14)15/h1H3,(H,7,8,9) |
| InChIKey | PDMRLGBDWHPGPW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 158.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|