C22H23ClF3N2O9P — CID 126525424
[(3S,4R,5R)-5-(5-carbamoyl-2H-pyridin-1-yl)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 126525424) has the molecular formula C22H23ClF3N2O9P and a molecular weight of 582.85 g/mol. Its IUPAC name is [(3S,4R,5R)-5-(5-carbamoyl-2H-pyridin-1-yl)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S,4R,5R)-5-(5-carbamoyl-2H-pyridin-1-yl)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 126525424 |
| Molecular Formula | C22H23ClF3N2O9P |
| Molecular Weight | 582.85 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | [(3S,4R,5R)-5-(5-carbamoyl-2H-pyridin-1-yl)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | NC(=O)C1=CN([C@@H]2OC(COP3(=O)OCCC(c4cccc(Cl)c4)O3)[C@@H](OC(=O)C(F)(F)F)[C@H]2O)CC=C1 |
| InChI | InChI=1S/C22H23ClF3N2O9P/c23-14-5-1-3-12(9-14)15-6-8-33-38(32,37-15)34-11-16-18(36-21(31)22(24,25)26)17(29)20(35-16)28-7-2-4-13(10-28)19(27)30/h1-5,9-10,15-18,20,29H,6-8,11H2,(H2,27,30)/t15?,16?,17-,18-,20-,38?/m1/s1 |
| InChIKey | JAONZAJNVFBCRZ-BCKBZVNHSA-N |
| XLogP | 2.74 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|