C23H32ClN2O8P — CID 134557515
1-[(2S)-4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-2-(2-hydroxypropan-2-yloxy)-3-methoxybutyl]-4H-pyridine-3-carboxamide (PubChem CID 134557515) has the molecular formula C23H32ClN2O8P and a molecular weight of 530.94 g/mol. Its IUPAC name is 1-[(2S)-4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-2-(2-hydroxypropan-2-yloxy)-3-methoxybutyl]-4H-pyridine-3-carboxamide.
| Compound Name | 1-[(2S)-4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-2-(2-hydroxypropan-2-yloxy)-3-methoxybutyl]-4H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134557515 |
| Molecular Formula | C23H32ClN2O8P |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 1-[(2S)-4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-2-(2-hydroxypropan-2-yloxy)-3-methoxybutyl]-4H-pyridine-3-carboxamide |
| SMILES | COC(COP1(=O)OCCC(c2cccc(Cl)c2)O1)[C@H](CN1C=CCC(C(N)=O)=C1)OC(C)(C)O |
| InChI | InChI=1S/C23H32ClN2O8P/c1-23(2,28)33-20(14-26-10-5-7-17(13-26)22(25)27)21(30-3)15-32-35(29)31-11-9-19(34-35)16-6-4-8-18(24)12-16/h4-6,8,10,12-13,19-21,28H,7,9,11,14-15H2,1-3H3,(H2,25,27)/t19?,20-,21?,35?/m0/s1 |
| InChIKey | ZWOGEXMYPLNAPV-HEARCFGKSA-N |
| XLogP | 3.66 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|