C34H47IOPSi+ — CID 126959591
3-[4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-6-bicyclo[3.1.0]hexanyl]propyl-triphenylphosphanium;hydroiodide (PubChem CID 126959591) has the molecular formula C34H47IOPSi+ and a molecular weight of 657.71 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-6-bicyclo[3.1.0]hexanyl]propyl-triphenylphosphanium;hydroiodide.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-6-bicyclo[3.1.0]hexanyl]propyl-triphenylphosphanium;hydroiodide |
|---|---|
| PubChem CID | 126959591 |
| Molecular Formula | C34H47IOPSi+ |
| Molecular Weight | 657.71 g/mol |
| Exact Mass | 657.22 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-6-bicyclo[3.1.0]hexanyl]propyl-triphenylphosphanium;hydroiodide |
| SMILES | CC12CCC(O[Si](C)(C)C(C)(C)C)C1C2CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C34H46OPSi.HI/c1-33(2,3)37(5,6)35-31-24-25-34(4)30(32(31)34)23-16-26-36(27-17-10-7-11-18-27,28-19-12-8-13-20-28)29-21-14-9-15-22-29;/h7-15,17-22,30-32H,16,23-26H2,1-6H3;1H/q+1; |
| InChIKey | OJEFPYDYXTTZKI-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.71 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|