C35H50BNO5PSi+ — CID 91361759
[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxoethyl)pyrrolidin-1-yl]-methylborinic acid;(3-methoxy-3-oxopropyl)-triphenylphosphanium (PubChem CID 91361759) has the molecular formula C35H50BNO5PSi+ and a molecular weight of 634.66 g/mol. Its IUPAC name is [(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxoethyl)pyrrolidin-1-yl]-methylborinic acid;(3-methoxy-3-oxopropyl)-triphenylphosphanium.
| Compound Name | [(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxoethyl)pyrrolidin-1-yl]-methylborinic acid;(3-methoxy-3-oxopropyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 91361759 |
| Molecular Formula | C35H50BNO5PSi+ |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | [(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxoethyl)pyrrolidin-1-yl]-methylborinic acid;(3-methoxy-3-oxopropyl)-triphenylphosphanium |
| SMILES | CB(O)N1CCC(O[Si](C)(C)C(C)(C)C)[C@@H]1CC=O.COC(=O)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22O2P.C13H28BNO3Si/c1-24-22(23)17-18-25(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;1-13(2,3)19(5,6)18-12-7-9-15(14(4)17)11(12)8-10-16/h2-16H,17-18H2,1H3;10-12,17H,7-9H2,1-6H3/q+1;/t;11-,12?/m.0/s1 |
| InChIKey | STZWDPPWSPTDHU-UIASNDIYSA-N |
| XLogP | 5.69 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|