About sodium;oxaldehydate;sulfanediol
sodium;oxaldehydate;sulfanediol (PubChem CID 129165189) has the molecular formula C2H3NaO5S
and a molecular weight of 162.10 g/mol. Its IUPAC name is sodium;oxaldehydate;sulfanediol.
Molecular Properties
| Compound Name | sodium;oxaldehydate;sulfanediol |
| PubChem CID | 129165189 |
| Molecular Formula | C2H3NaO5S |
| Molecular Weight | 162.10 g/mol |
| Exact Mass | 161.96 |
| IUPAC Name | sodium;oxaldehydate;sulfanediol |
| SMILES | O=CC(=O)[O-].OSO.[Na+] |
| InChI | InChI=1S/C2H2O3.Na.H2O2S/c3-1-2(4)5;;1-3-2/h1H,(H,4,5);;1-2H/q;+1;/p-1 |
| InChIKey | BXDJAMUWAGMFID-UHFFFAOYSA-M |
| XLogP | -4.40 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.10 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;oxaldehydate;sulfanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;oxaldehydate;sulfanediol?
The IUPAC name of sodium;oxaldehydate;sulfanediol (CID 129165189) is sodium;oxaldehydate;sulfanediol.
What is the SMILES notation for sodium;oxaldehydate;sulfanediol?
The canonical SMILES for sodium;oxaldehydate;sulfanediol is O=CC(=O)[O-].OSO.[Na+].
What is the InChIKey of sodium;oxaldehydate;sulfanediol?
The InChIKey is BXDJAMUWAGMFID-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2O3.Na.H2O2S/c3-1-2(4)5;;1-3-2/h1H,(H,4,5);;1-2H/q;+1;/p-1.
What are the key properties of sodium;oxaldehydate;sulfanediol?
sodium;oxaldehydate;sulfanediol has a molecular weight of 162.10 g/mol, XLogP of -4.40, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;oxaldehydate;sulfanediol is sourced from PubChem (CID 129165189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).