About manganese(2+);oxaldehydate
manganese(2+);oxaldehydate (PubChem CID 88753810) has the molecular formula C4H2MnO6
and a molecular weight of 200.99 g/mol. Its IUPAC name is manganese(2+);oxaldehydate.
Molecular Properties
| Compound Name | manganese(2+);oxaldehydate |
| PubChem CID | 88753810 |
| Molecular Formula | C4H2MnO6 |
| Molecular Weight | 200.99 g/mol |
| Exact Mass | 200.92 |
| IUPAC Name | manganese(2+);oxaldehydate |
| SMILES | O=CC(=O)[O-].O=CC(=O)[O-].[Mn+2] |
| InChI | InChI=1S/2C2H2O3.Mn/c2*3-1-2(4)5;/h2*1H,(H,4,5);/q;;+2/p-2 |
| InChIKey | ZEOUCSDCKQKJRY-UHFFFAOYSA-L |
| XLogP | -4.13 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.99 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);oxaldehydate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);oxaldehydate?
The IUPAC name of manganese(2+);oxaldehydate (CID 88753810) is manganese(2+);oxaldehydate.
What is the SMILES notation for manganese(2+);oxaldehydate?
The canonical SMILES for manganese(2+);oxaldehydate is O=CC(=O)[O-].O=CC(=O)[O-].[Mn+2].
What is the InChIKey of manganese(2+);oxaldehydate?
The InChIKey is ZEOUCSDCKQKJRY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H2O3.Mn/c2*3-1-2(4)5;/h2*1H,(H,4,5);/q;;+2/p-2.
What are the key properties of manganese(2+);oxaldehydate?
manganese(2+);oxaldehydate has a molecular weight of 200.99 g/mol, XLogP of -4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);oxaldehydate is sourced from PubChem (CID 88753810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).