About sodium;oxaldehydate;hydrate
sodium;oxaldehydate;hydrate (PubChem CID 23720423) has the molecular formula C2H3NaO4
and a molecular weight of 114.03 g/mol. Its IUPAC name is sodium;oxaldehydate;hydrate.
Molecular Properties
| Compound Name | sodium;oxaldehydate;hydrate |
| PubChem CID | 23720423 |
| Molecular Formula | C2H3NaO4 |
| Molecular Weight | 114.03 g/mol |
| Exact Mass | 113.99 |
| IUPAC Name | sodium;oxaldehydate;hydrate |
| SMILES | O.O=CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H2O3.Na.H2O/c3-1-2(4)5;;/h1H,(H,4,5);;1H2/q;+1;/p-1 |
| InChIKey | VPWPWKBHCGJTTQ-UHFFFAOYSA-M |
| XLogP | -5.89 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.03 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;oxaldehydate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;oxaldehydate;hydrate?
The IUPAC name of sodium;oxaldehydate;hydrate (CID 23720423) is sodium;oxaldehydate;hydrate.
What is the SMILES notation for sodium;oxaldehydate;hydrate?
The canonical SMILES for sodium;oxaldehydate;hydrate is O.O=CC(=O)[O-].[Na+].
What is the InChIKey of sodium;oxaldehydate;hydrate?
The InChIKey is VPWPWKBHCGJTTQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2O3.Na.H2O/c3-1-2(4)5;;/h1H,(H,4,5);;1H2/q;+1;/p-1.
What are the key properties of sodium;oxaldehydate;hydrate?
sodium;oxaldehydate;hydrate has a molecular weight of 114.03 g/mol, XLogP of -5.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;oxaldehydate;hydrate is sourced from PubChem (CID 23720423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).