C25H24F6N2O6S — CID 129205089
5-(cyclopropylmethylsulfonyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(2-methoxyacetyl)-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205089) has the molecular formula C25H24F6N2O6S and a molecular weight of 594.53 g/mol. Its IUPAC name is 5-(cyclopropylmethylsulfonyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(2-methoxyacetyl)-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 5-(cyclopropylmethylsulfonyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(2-methoxyacetyl)-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205089 |
| Molecular Formula | C25H24F6N2O6S |
| Molecular Weight | 594.53 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | 5-(cyclopropylmethylsulfonyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(2-methoxyacetyl)-1,3-dihydroisoindole-1-carboxamide |
| SMILES | COCC(=O)N1Cc2cc(S(=O)(=O)CC3CC3)ccc2C1C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H24F6N2O6S/c1-39-12-20(34)33-11-15-10-18(40(37,38)13-14-2-3-14)8-9-19(15)21(33)22(35)32-17-6-4-16(5-7-17)23(36,24(26,27)28)25(29,30)31/h4-10,14,21,36H,2-3,11-13H2,1H3,(H,32,35) |
| InChIKey | JKDVOVFYDAXBSL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |