C24H22F6N2O6S — CID 129205125
5-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(oxetane-2-carbonyl)-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205125) has the molecular formula C24H22F6N2O6S and a molecular weight of 580.50 g/mol. Its IUPAC name is 5-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(oxetane-2-carbonyl)-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 5-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(oxetane-2-carbonyl)-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205125 |
| Molecular Formula | C24H22F6N2O6S |
| Molecular Weight | 580.50 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | 5-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(oxetane-2-carbonyl)-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)CN(C(=O)C1CCO1)C2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H22F6N2O6S/c1-2-39(36,37)16-7-8-17-13(11-16)12-32(21(34)18-9-10-38-18)19(17)20(33)31-15-5-3-14(4-6-15)22(35,23(25,26)27)24(28,29)30/h3-8,11,18-19,35H,2,9-10,12H2,1H3,(H,31,33) |
| InChIKey | IZUSAUVLJFVZBH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |