C29H37Cl2N3O5 — CID 129274318
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-hydroxy-2H-quinolin-1-yl]methyl 2-methylpropyl carbonate (PubChem CID 129274318) has the molecular formula C29H37Cl2N3O5 and a molecular weight of 578.54 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-hydroxy-2H-quinolin-1-yl]methyl 2-methylpropyl carbonate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-hydroxy-2H-quinolin-1-yl]methyl 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 129274318 |
| Molecular Formula | C29H37Cl2N3O5 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-hydroxy-2H-quinolin-1-yl]methyl 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)OCN1c2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccc2C=CC1O |
| InChI | InChI=1S/C29H37Cl2N3O5/c1-21(2)19-38-29(36)39-20-34-26-18-23(10-8-22(26)9-11-27(34)35)37-17-4-3-12-32-13-15-33(16-14-32)25-7-5-6-24(30)28(25)31/h5-11,18,21,27,35H,3-4,12-17,19-20H2,1-2H3 |
| InChIKey | JLQYOMFLCYGSJY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|