C26H23BrF11NO4S — CID 130236390
4-[(E)-3-[3-bromo-5-(2,2,2-trifluoroethoxy)phenyl]-4,4-difluoropent-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236390) has the molecular formula C26H23BrF11NO4S and a molecular weight of 734.42 g/mol. Its IUPAC name is 4-[(E)-3-[3-bromo-5-(2,2,2-trifluoroethoxy)phenyl]-4,4-difluoropent-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(E)-3-[3-bromo-5-(2,2,2-trifluoroethoxy)phenyl]-4,4-difluoropent-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236390 |
| Molecular Formula | C26H23BrF11NO4S |
| Molecular Weight | 734.42 g/mol |
| Exact Mass | 733.04 |
| IUPAC Name | 4-[(E)-3-[3-bromo-5-(2,2,2-trifluoroethoxy)phenyl]-4,4-difluoropent-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(CS(=O)(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Br)cc(OCC(F)(F)F)c2)C(C)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C26H23BrF11NO4S/c1-14(11-44(41,42)13-25(33,34)35)39-22(40)19-5-3-15(7-21(19)26(36,37)38)4-6-20(23(2,28)29)16-8-17(27)10-18(9-16)43-12-24(30,31)32/h3-10,14,20H,11-13H2,1-2H3,(H,39,40)/b6-4+ |
| InChIKey | GAMOLPIDIVCWKN-GQCTYLIASA-N |
| XLogP | 7.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.42 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |