C23H13BrCl2F10N2O3 — CID 130236866
4-[(Z)-3-(3-bromo-4,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236866) has the molecular formula C23H13BrCl2F10N2O3 and a molecular weight of 706.16 g/mol. Its IUPAC name is 4-[(Z)-3-(3-bromo-4,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3-bromo-4,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236866 |
| Molecular Formula | C23H13BrCl2F10N2O3 |
| Molecular Weight | 706.16 g/mol |
| Exact Mass | 703.93 |
| IUPAC Name | 4-[(Z)-3-(3-bromo-4,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CON(CC(F)(F)F)C1=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Br)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H13BrCl2F10N2O3/c24-14-4-10(5-15(25)18(14)26)12(22(31,32)33)6-16(27)9-1-2-11(13(3-9)23(34,35)36)19(39)37-17-7-41-38(20(17)40)8-21(28,29)30/h1-6,12,17H,7-8H2,(H,37,39)/b16-6- |
| InChIKey | CKZQWSXYPIOHJB-SOFYXZRVSA-N |
| XLogP | 7.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.16 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|