C8H5F13N2 — CID 130266565
2,2,3,3,5,5,6,6-octafluoro-1-methyl-4-(1,1,2,2,3-pentafluoropropyl)piperazine (PubChem CID 130266565) has the molecular formula C8H5F13N2 and a molecular weight of 376.12 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-1-methyl-4-(1,1,2,2,3-pentafluoropropyl)piperazine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-1-methyl-4-(1,1,2,2,3-pentafluoropropyl)piperazine |
|---|---|
| PubChem CID | 130266565 |
| Molecular Formula | C8H5F13N2 |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-1-methyl-4-(1,1,2,2,3-pentafluoropropyl)piperazine |
| SMILES | CN1C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)CF)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H5F13N2/c1-22-5(14,15)7(18,19)23(8(20,21)6(22,16)17)4(12,13)3(10,11)2-9/h2H2,1H3 |
| InChIKey | MMRNSZUPTMVXIX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|