C8H3F14N — CID 130266502
2,2,3,3,4,4,6,6,7,7-decafluoro-5-(fluoromethyl)-1-(trifluoromethyl)azepane (PubChem CID 130266502) has the molecular formula C8H3F14N and a molecular weight of 379.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,6,6,7,7-decafluoro-5-(fluoromethyl)-1-(trifluoromethyl)azepane.
| Compound Name | 2,2,3,3,4,4,6,6,7,7-decafluoro-5-(fluoromethyl)-1-(trifluoromethyl)azepane |
|---|---|
| PubChem CID | 130266502 |
| Molecular Formula | C8H3F14N |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2,2,3,3,4,4,6,6,7,7-decafluoro-5-(fluoromethyl)-1-(trifluoromethyl)azepane |
| SMILES | FCC1C(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H3F14N/c9-1-2-3(10,11)5(14,15)7(18,19)23(8(20,21)22)6(16,17)4(2,12)13/h2H,1H2 |
| InChIKey | LCKMAXXFFLOIBJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|