C37H22F6N4 — CID 130459863
[6-cyanoimino-4a-methyl-2,8-bis[3-(trifluoromethyl)phenyl]-10,12a-dihydro-9H-indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 130459863) has the molecular formula C37H22F6N4 and a molecular weight of 636.60 g/mol. Its IUPAC name is [6-cyanoimino-4a-methyl-2,8-bis[3-(trifluoromethyl)phenyl]-10,12a-dihydro-9H-indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [6-cyanoimino-4a-methyl-2,8-bis[3-(trifluoromethyl)phenyl]-10,12a-dihydro-9H-indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 130459863 |
| Molecular Formula | C37H22F6N4 |
| Molecular Weight | 636.60 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | [6-cyanoimino-4a-methyl-2,8-bis[3-(trifluoromethyl)phenyl]-10,12a-dihydro-9H-indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | CC12C=CC(c3cccc(C(F)(F)F)c3)=CC1/C(=N/C#N)c1cc3c(cc12)/C(=N/C#N)C1=C3CCC(c2cccc(C(F)(F)F)c2)=C1 |
| InChI | InChI=1S/C37H22F6N4/c1-35-11-10-23(21-5-3-7-25(13-21)37(41,42)43)15-32(35)34(47-19-45)30-16-27-26-9-8-22(20-4-2-6-24(12-20)36(38,39)40)14-28(26)33(46-18-44)29(27)17-31(30)35/h2-7,10-17,32H,8-9H2,1H3/b46-33+,47-34+ |
| InChIKey | STHDMYZBCTTXME-LFDKMKOQSA-N |
| XLogP | 9.45 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.60 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|