About N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide
N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide (PubChem CID 130582079) has the molecular formula C6H9N3O3S
and a molecular weight of 203.22 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide |
| PubChem CID | 130582079 |
| Molecular Formula | C6H9N3O3S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide |
| SMILES | CS(C)(=O)=NC(=O)C(=O)NCC#N |
| InChI | InChI=1S/C6H9N3O3S/c1-13(2,12)9-6(11)5(10)8-4-3-7/h4H2,1-2H3,(H,8,10) |
| InChIKey | BMFUICDENZRYDW-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide?
The IUPAC name of N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide (CID 130582079) is N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide.
What is the SMILES notation for N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide?
The canonical SMILES for N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide is CS(C)(=O)=NC(=O)C(=O)NCC#N.
What is the InChIKey of N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide?
The InChIKey is BMFUICDENZRYDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3S/c1-13(2,12)9-6(11)5(10)8-4-3-7/h4H2,1-2H3,(H,8,10).
What are the key properties of N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide?
N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide has a molecular weight of 203.22 g/mol, XLogP of -1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N'-[dimethyl(oxo)-λ6-sulfanylidene]oxamide is sourced from PubChem (CID 130582079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).