C15H21N — CID 131980537
(Z)-5-cyclopropyl-5-methyl-4,6-dimethylidenenon-2-en-7-yn-2-amine (PubChem CID 131980537) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (Z)-5-cyclopropyl-5-methyl-4,6-dimethylidenenon-2-en-7-yn-2-amine.
| Compound Name | (Z)-5-cyclopropyl-5-methyl-4,6-dimethylidenenon-2-en-7-yn-2-amine |
|---|---|
| PubChem CID | 131980537 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (Z)-5-cyclopropyl-5-methyl-4,6-dimethylidenenon-2-en-7-yn-2-amine |
| SMILES | C=C(C#CC)C(C)(C(=C)/C=C(/C)N)C1CC1 |
| InChI | InChI=1S/C15H21N/c1-6-7-11(2)15(5,14-8-9-14)12(3)10-13(4)16/h10,14H,2-3,8-9,16H2,1,4-5H3/b13-10- |
| InChIKey | LQGLVOHEGFVMMM-RAXLEYEMSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|