C19H15N3O3 — CID 13199438
2-[4-(1H-indazol-3-yl)-4-oxobutyl]isoindole-1,3-dione (PubChem CID 13199438) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[4-(1H-indazol-3-yl)-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(1H-indazol-3-yl)-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 13199438 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[4-(1H-indazol-3-yl)-4-oxobutyl]isoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C19H15N3O3/c23-16(17-14-8-3-4-9-15(14)20-21-17)10-5-11-22-18(24)12-6-1-2-7-13(12)19(22)25/h1-4,6-9H,5,10-11H2,(H,20,21) |
| InChIKey | QJZBOGMFONWCRP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|