C26H32Cl2N4O2 — CID 132540833
1-[(4aR,8S,8aS)-8-(3-hydroxypyrrolidin-1-yl)-4-(pyridin-3-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 132540833) has the molecular formula C26H32Cl2N4O2 and a molecular weight of 503.47 g/mol. Its IUPAC name is 1-[(4aR,8S,8aS)-8-(3-hydroxypyrrolidin-1-yl)-4-(pyridin-3-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(4aR,8S,8aS)-8-(3-hydroxypyrrolidin-1-yl)-4-(pyridin-3-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 132540833 |
| Molecular Formula | C26H32Cl2N4O2 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 1-[(4aR,8S,8aS)-8-(3-hydroxypyrrolidin-1-yl)-4-(pyridin-3-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCN(Cc2cccnc2)[C@@H]2CCC[C@H](N3CCC(O)C3)[C@H]21 |
| InChI | InChI=1S/C26H32Cl2N4O2/c27-21-7-6-18(13-22(21)28)14-25(34)32-12-11-31(16-19-3-2-9-29-15-19)24-5-1-4-23(26(24)32)30-10-8-20(33)17-30/h2-3,6-7,9,13,15,20,23-24,26,33H,1,4-5,8,10-12,14,16-17H2/t20?,23-,24+,26+/m0/s1 |
| InChIKey | CFCHIEDCTWPVCJ-NYOWHNLLSA-N |
| XLogP | 3.63 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |