C38H50O7 — CID 134198145
2-[3-cyclohexyl-6-[4-(3-hydroxypropyl)phenyl]-2-[2-(2-methylprop-2-enoxy)ethyl]-4-(2-methylprop-2-enoyloxymethyl)phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134198145) has the molecular formula C38H50O7 and a molecular weight of 618.81 g/mol. Its IUPAC name is 2-[3-cyclohexyl-6-[4-(3-hydroxypropyl)phenyl]-2-[2-(2-methylprop-2-enoxy)ethyl]-4-(2-methylprop-2-enoyloxymethyl)phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-cyclohexyl-6-[4-(3-hydroxypropyl)phenyl]-2-[2-(2-methylprop-2-enoxy)ethyl]-4-(2-methylprop-2-enoyloxymethyl)phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134198145 |
| Molecular Formula | C38H50O7 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | 2-[3-cyclohexyl-6-[4-(3-hydroxypropyl)phenyl]-2-[2-(2-methylprop-2-enoxy)ethyl]-4-(2-methylprop-2-enoyloxymethyl)phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)COCCc1c(OCCOC(=O)C(=C)C)c(-c2ccc(CCCO)cc2)cc(COC(=O)C(=C)C)c1C1CCCCC1 |
| InChI | InChI=1S/C38H50O7/c1-26(2)24-42-20-18-33-35(31-12-8-7-9-13-31)32(25-45-38(41)28(5)6)23-34(30-16-14-29(15-17-30)11-10-19-39)36(33)43-21-22-44-37(40)27(3)4/h14-17,23,31,39H,1,3,5,7-13,18-22,24-25H2,2,4,6H3 |
| InChIKey | HBJWFYWSEFQPSF-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|