C27H32F4O3 — CID 134246670
[2-[3-ethyl-4-[2-[4-(4-fluorobutyl)phenyl]ethyl]phenyl]-3-hydroxypropyl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 134246670) has the molecular formula C27H32F4O3 and a molecular weight of 480.54 g/mol. Its IUPAC name is [2-[3-ethyl-4-[2-[4-(4-fluorobutyl)phenyl]ethyl]phenyl]-3-hydroxypropyl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-[3-ethyl-4-[2-[4-(4-fluorobutyl)phenyl]ethyl]phenyl]-3-hydroxypropyl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246670 |
| Molecular Formula | C27H32F4O3 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [2-[3-ethyl-4-[2-[4-(4-fluorobutyl)phenyl]ethyl]phenyl]-3-hydroxypropyl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCC(CO)c1ccc(CCc2ccc(CCCCF)cc2)c(CC)c1)C(F)(F)F |
| InChI | InChI=1S/C27H32F4O3/c1-3-22-16-24(25(17-32)18-34-26(33)19(2)27(29,30)31)14-13-23(22)12-11-21-9-7-20(8-10-21)6-4-5-15-28/h7-10,13-14,16,25,32H,2-6,11-12,15,17-18H2,1H3 |
| InChIKey | OGNXTZZRTQAUAH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|