C38H46O3 — CID 134246709
[3-hydroxy-2-[7-[4-[2-(4-propylcyclohexyl)ethyl]phenyl]-9,10-dihydrophenanthren-2-yl]propyl] 2-methylprop-2-enoate (PubChem CID 134246709) has the molecular formula C38H46O3 and a molecular weight of 550.78 g/mol. Its IUPAC name is [3-hydroxy-2-[7-[4-[2-(4-propylcyclohexyl)ethyl]phenyl]-9,10-dihydrophenanthren-2-yl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-2-[7-[4-[2-(4-propylcyclohexyl)ethyl]phenyl]-9,10-dihydrophenanthren-2-yl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134246709 |
| Molecular Formula | C38H46O3 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | [3-hydroxy-2-[7-[4-[2-(4-propylcyclohexyl)ethyl]phenyl]-9,10-dihydrophenanthren-2-yl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)c1ccc2c(c1)CCc1cc(-c3ccc(CCC4CCC(CCC)CC4)cc3)ccc1-2 |
| InChI | InChI=1S/C38H46O3/c1-4-5-27-6-8-28(9-7-27)10-11-29-12-14-30(15-13-29)31-18-20-36-33(22-31)16-17-34-23-32(19-21-37(34)36)35(24-39)25-41-38(40)26(2)3/h12-15,18-23,27-28,35,39H,2,4-11,16-17,24-25H2,1,3H3 |
| InChIKey | JDDLKUSWFHEPBF-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|