C20H27NO6 — CID 134294332
tert-butyl [2,5,7,8-tetramethyl-2-[(E)-2-nitroethenyl]-3,4-dihydrochromen-6-yl] carbonate (PubChem CID 134294332) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is tert-butyl [2,5,7,8-tetramethyl-2-[(E)-2-nitroethenyl]-3,4-dihydrochromen-6-yl] carbonate.
| Compound Name | tert-butyl [2,5,7,8-tetramethyl-2-[(E)-2-nitroethenyl]-3,4-dihydrochromen-6-yl] carbonate |
|---|---|
| PubChem CID | 134294332 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | tert-butyl [2,5,7,8-tetramethyl-2-[(E)-2-nitroethenyl]-3,4-dihydrochromen-6-yl] carbonate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)OC(C)(C)C)CCC(C)(/C=C/[N+](=O)[O-])O2 |
| InChI | InChI=1S/C20H27NO6/c1-12-13(2)17-15(8-9-20(7,26-17)10-11-21(23)24)14(3)16(12)25-18(22)27-19(4,5)6/h10-11H,8-9H2,1-7H3/b11-10+ |
| InChIKey | LWBCWCNLLXFJLL-ZHACJKMWSA-N |
| XLogP | 4.80 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|