C23H33NO6 — CID 134294333
tert-butyl [2,5,7,8-tetramethyl-2-[(E)-2-nitropent-1-enyl]-3,4-dihydrochromen-6-yl] carbonate (PubChem CID 134294333) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl [2,5,7,8-tetramethyl-2-[(E)-2-nitropent-1-enyl]-3,4-dihydrochromen-6-yl] carbonate.
| Compound Name | tert-butyl [2,5,7,8-tetramethyl-2-[(E)-2-nitropent-1-enyl]-3,4-dihydrochromen-6-yl] carbonate |
|---|---|
| PubChem CID | 134294333 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | tert-butyl [2,5,7,8-tetramethyl-2-[(E)-2-nitropent-1-enyl]-3,4-dihydrochromen-6-yl] carbonate |
| SMILES | CCC/C(=C\C1(C)CCc2c(C)c(OC(=O)OC(C)(C)C)c(C)c(C)c2O1)[N+](=O)[O-] |
| InChI | InChI=1S/C23H33NO6/c1-9-10-17(24(26)27)13-23(8)12-11-18-16(4)19(14(2)15(3)20(18)29-23)28-21(25)30-22(5,6)7/h13H,9-12H2,1-8H3/b17-13+ |
| InChIKey | CWZYMCYCNBCZHS-GHRIWEEISA-N |
| XLogP | 5.97 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|