C26H40O3 — CID 145191704
[2,5,7,8-tetramethyl-2-(2,5,5-trimethylhexan-2-yl)-3,4-dihydrochromen-6-yl] 2-methylprop-2-enoate (PubChem CID 145191704) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is [2,5,7,8-tetramethyl-2-(2,5,5-trimethylhexan-2-yl)-3,4-dihydrochromen-6-yl] 2-methylprop-2-enoate.
| Compound Name | [2,5,7,8-tetramethyl-2-(2,5,5-trimethylhexan-2-yl)-3,4-dihydrochromen-6-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145191704 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | [2,5,7,8-tetramethyl-2-(2,5,5-trimethylhexan-2-yl)-3,4-dihydrochromen-6-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(C(C)(C)CCC(C)(C)C)O2 |
| InChI | InChI=1S/C26H40O3/c1-16(2)23(27)28-21-17(3)18(4)22-20(19(21)5)12-13-26(11,29-22)25(9,10)15-14-24(6,7)8/h1,12-15H2,2-11H3 |
| InChIKey | CQCVMVNTMIPZPT-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|