C32H28F6N2O8 — CID 134515029
2-[5-[1,1,1,3,3,3-hexafluoro-2-[2-[2-(2-methylpropanoyloxy)ethyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl]ethyl (E)-2-methylbut-2-enoate (PubChem CID 134515029) has the molecular formula C32H28F6N2O8 and a molecular weight of 682.57 g/mol. Its IUPAC name is 2-[5-[1,1,1,3,3,3-hexafluoro-2-[2-[2-(2-methylpropanoyloxy)ethyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl]ethyl (E)-2-methylbut-2-enoate.
| Compound Name | 2-[5-[1,1,1,3,3,3-hexafluoro-2-[2-[2-(2-methylpropanoyloxy)ethyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl]ethyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 134515029 |
| Molecular Formula | C32H28F6N2O8 |
| Molecular Weight | 682.57 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | 2-[5-[1,1,1,3,3,3-hexafluoro-2-[2-[2-(2-methylpropanoyloxy)ethyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl]ethyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OCCN1C(=O)c2ccc(C(c3ccc4c(c3)C(=O)N(CCOC(=O)C(C)C)C4=O)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C32H28F6N2O8/c1-5-17(4)29(46)48-13-11-40-25(42)21-9-7-19(15-23(21)27(40)44)30(31(33,34)35,32(36,37)38)18-6-8-20-22(14-18)26(43)39(24(20)41)10-12-47-28(45)16(2)3/h5-9,14-16H,10-13H2,1-4H3/b17-5+ |
| InChIKey | ZCYYHNJNHCETJV-YAXRCOADSA-N |
| XLogP | 5.00 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|