C25H33F3N2O5 — CID 134531818
N'-[4-[3-[2-(3,4-dimethoxyphenyl)ethoxy]-1,1,1-trifluoro-2-hydroxypropan-2-yl]-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 134531818) has the molecular formula C25H33F3N2O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is N'-[4-[3-[2-(3,4-dimethoxyphenyl)ethoxy]-1,1,1-trifluoro-2-hydroxypropan-2-yl]-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[3-[2-(3,4-dimethoxyphenyl)ethoxy]-1,1,1-trifluoro-2-hydroxypropan-2-yl]-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 134531818 |
| Molecular Formula | C25H33F3N2O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N'-[4-[3-[2-(3,4-dimethoxyphenyl)ethoxy]-1,1,1-trifluoro-2-hydroxypropan-2-yl]-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)c(C(O)(COCCc2ccc(OC)c(OC)c2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C25H33F3N2O5/c1-7-30(3)16-29-20-14-22(33-5)19(12-17(20)2)24(31,25(26,27)28)15-35-11-10-18-8-9-21(32-4)23(13-18)34-6/h8-9,12-14,16,31H,7,10-11,15H2,1-6H3/b29-16+ |
| InChIKey | DEEYJEAPYVZXMX-MUFRIFMGSA-N |
| XLogP | 4.64 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|