C14H17BN2O5 — CID 134812074
6-methyl-2-[methyl-[(E)-2-phenylethenyl]amino]oxy-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 134812074) has the molecular formula C14H17BN2O5 and a molecular weight of 304.11 g/mol. Its IUPAC name is 6-methyl-2-[methyl-[(E)-2-phenylethenyl]amino]oxy-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[methyl-[(E)-2-phenylethenyl]amino]oxy-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 134812074 |
| Molecular Formula | C14H17BN2O5 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-methyl-2-[methyl-[(E)-2-phenylethenyl]amino]oxy-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(ON(C)/C=C/c2ccccc2)OC(=O)C1 |
| InChI | InChI=1S/C14H17BN2O5/c1-16-10-13(18)20-15(21-14(19)11-16)22-17(2)9-8-12-6-4-3-5-7-12/h3-9H,10-11H2,1-2H3/b9-8+ |
| InChIKey | YQTFSBAEDVZQTN-CMDGGOBGSA-N |
| XLogP | 0.54 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|