C28H38O5Si2 — CID 134840502
(1R,4S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-1-(2-trimethylsilylethynyl)spiro[8-oxabicyclo[3.2.1]oct-2-ene-7,3'-furan]-2'-one (PubChem CID 134840502) has the molecular formula C28H38O5Si2 and a molecular weight of 510.78 g/mol. Its IUPAC name is (1R,4S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-1-(2-trimethylsilylethynyl)spiro[8-oxabicyclo[3.2.1]oct-2-ene-7,3'-furan]-2'-one.
| Compound Name | (1R,4S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-1-(2-trimethylsilylethynyl)spiro[8-oxabicyclo[3.2.1]oct-2-ene-7,3'-furan]-2'-one |
|---|---|
| PubChem CID | 134840502 |
| Molecular Formula | C28H38O5Si2 |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (1R,4S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-1-(2-trimethylsilylethynyl)spiro[8-oxabicyclo[3.2.1]oct-2-ene-7,3'-furan]-2'-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C2O[C@](C#C[Si](C)(C)C)(C=C[C@@H]2OCc2ccccc2)[C@]12C=COC2=O |
| InChI | InChI=1S/C28H38O5Si2/c1-26(2,3)35(7,8)33-24-23-22(31-20-21-12-10-9-11-13-21)14-15-27(32-23,17-19-34(4,5)6)28(24)16-18-30-25(28)29/h9-16,18,22-24H,20H2,1-8H3/t22-,23?,24+,27-,28+/m0/s1 |
| InChIKey | JNQJQIIUHLIOFR-HITDYKBWSA-N |
| XLogP | 5.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|