C15H17N3O2 — CID 134843969
2,6-dimethoxy-N-phenyl-5-prop-2-enylpyrimidin-4-amine (PubChem CID 134843969) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2,6-dimethoxy-N-phenyl-5-prop-2-enylpyrimidin-4-amine.
| Compound Name | 2,6-dimethoxy-N-phenyl-5-prop-2-enylpyrimidin-4-amine |
|---|---|
| PubChem CID | 134843969 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2,6-dimethoxy-N-phenyl-5-prop-2-enylpyrimidin-4-amine |
| SMILES | C=CCc1c(Nc2ccccc2)nc(OC)nc1OC |
| InChI | InChI=1S/C15H17N3O2/c1-4-8-12-13(16-11-9-6-5-7-10-11)17-15(20-3)18-14(12)19-2/h4-7,9-10H,1,8H2,2-3H3,(H,16,17,18) |
| InChIKey | HFKGNURGXRFOBB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|