C32H54O7Si2 — CID 134852542
2-[(1S,3R,4S,5R,7R,8S,9S,11R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(phenylmethoxymethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetaldehyde (PubChem CID 134852542) has the molecular formula C32H54O7Si2 and a molecular weight of 606.95 g/mol. Its IUPAC name is 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(phenylmethoxymethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetaldehyde.
| Compound Name | 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(phenylmethoxymethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetaldehyde |
|---|---|
| PubChem CID | 134852542 |
| Molecular Formula | C32H54O7Si2 |
| Molecular Weight | 606.95 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | 2-[(1S,3R,4S,5R,7R,8S,9S,11R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(phenylmethoxymethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H]2O[C@H](COCc3ccccc3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@H]2CC[C@H](CC=O)O[C@H]12 |
| InChI | InChI=1S/C32H54O7Si2/c1-31(2,3)40(7,8)38-27-25(21-34-20-22-14-12-11-13-15-22)37-29-28(27)36-24-17-16-23(18-19-33)35-26(24)30(29)39-41(9,10)32(4,5)6/h11-15,19,23-30H,16-18,20-21H2,1-10H3/t23-,24+,25-,26+,27+,28+,29-,30+/m1/s1 |
| InChIKey | PDARSSVSNNVDNW-VEWOESKISA-N |
| XLogP | 6.66 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.95 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|