C25H56O4Si2 — CID 134863675
(2R,3S,4R,5R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyheptane-3,5-diol (PubChem CID 134863675) has the molecular formula C25H56O4Si2 and a molecular weight of 476.89 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyheptane-3,5-diol.
| Compound Name | (2R,3S,4R,5R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyheptane-3,5-diol |
|---|---|
| PubChem CID | 134863675 |
| Molecular Formula | C25H56O4Si2 |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | (2R,3S,4R,5R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyheptane-3,5-diol |
| SMILES | CC(C)[Si](OC[C@@H](C)[C@@H](O)[C@@H](C)[C@@H](O)[C@H](C)CO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H56O4Si2/c1-17(2)31(18(3)4,19(5)6)29-16-21(8)24(27)22(9)23(26)20(7)15-28-30(13,14)25(10,11)12/h17-24,26-27H,15-16H2,1-14H3/t20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | MCADGDXHQQZCCK-URYYLNOGSA-N |
| XLogP | 6.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|