C18H33NO4 — CID 134865028
tert-butyl N-[(1S,2R,6R)-2-hydroxy-6-methoxy-5,7-dimethyl-3-propan-2-ylcyclohept-3-en-1-yl]carbamate (PubChem CID 134865028) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R,6R)-2-hydroxy-6-methoxy-5,7-dimethyl-3-propan-2-ylcyclohept-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R,6R)-2-hydroxy-6-methoxy-5,7-dimethyl-3-propan-2-ylcyclohept-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 134865028 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl N-[(1S,2R,6R)-2-hydroxy-6-methoxy-5,7-dimethyl-3-propan-2-ylcyclohept-3-en-1-yl]carbamate |
| SMILES | CO[C@@H]1C(C)C=C(C(C)C)[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)C1C |
| InChI | InChI=1S/C18H33NO4/c1-10(2)13-9-11(3)16(22-8)12(4)14(15(13)20)19-17(21)23-18(5,6)7/h9-12,14-16,20H,1-8H3,(H,19,21)/t11?,12?,14-,15+,16+/m0/s1 |
| InChIKey | XCSAIQFIEDVXRP-MVKYRMLYSA-N |
| XLogP | 3.12 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|