C24H38O4S2 — CID 134905674
(5S)-5-[(3S,4R)-5-(1,3-dithian-2-yl)-4-(4-methoxyphenoxy)-3-methylpentyl]-2,2,4,4-tetramethyl-1,3-dioxolane (PubChem CID 134905674) has the molecular formula C24H38O4S2 and a molecular weight of 454.70 g/mol. Its IUPAC name is (5S)-5-[(3S,4R)-5-(1,3-dithian-2-yl)-4-(4-methoxyphenoxy)-3-methylpentyl]-2,2,4,4-tetramethyl-1,3-dioxolane.
| Compound Name | (5S)-5-[(3S,4R)-5-(1,3-dithian-2-yl)-4-(4-methoxyphenoxy)-3-methylpentyl]-2,2,4,4-tetramethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134905674 |
| Molecular Formula | C24H38O4S2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (5S)-5-[(3S,4R)-5-(1,3-dithian-2-yl)-4-(4-methoxyphenoxy)-3-methylpentyl]-2,2,4,4-tetramethyl-1,3-dioxolane |
| SMILES | COc1ccc(O[C@H](CC2SCCCS2)[C@@H](C)CC[C@@H]2OC(C)(C)OC2(C)C)cc1 |
| InChI | InChI=1S/C24H38O4S2/c1-17(8-13-21-23(2,3)28-24(4,5)27-21)20(16-22-29-14-7-15-30-22)26-19-11-9-18(25-6)10-12-19/h9-12,17,20-22H,7-8,13-16H2,1-6H3/t17-,20+,21-/m0/s1 |
| InChIKey | JWGBSAPIIPPRGZ-WMQCIHAUSA-N |
| XLogP | 6.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |