C39H45NO3SSi — CID 134956490
[(3S)-6-benzyl-1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-2,3,4,7-tetrahydroazepin-5-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 134956490) has the molecular formula C39H45NO3SSi and a molecular weight of 635.95 g/mol. Its IUPAC name is [(3S)-6-benzyl-1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-2,3,4,7-tetrahydroazepin-5-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(3S)-6-benzyl-1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-2,3,4,7-tetrahydroazepin-5-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134956490 |
| Molecular Formula | C39H45NO3SSi |
| Molecular Weight | 635.95 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | [(3S)-6-benzyl-1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-2,3,4,7-tetrahydroazepin-5-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | C=C(C)[C@@H]1CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=C(Cc2ccccc2)CN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C39H45NO3SSi/c1-30(2)33-27-38(43-45(39(4,5)6,36-18-12-8-13-19-36)37-20-14-9-15-21-37)34(26-32-16-10-7-11-17-32)29-40(28-33)44(41,42)35-24-22-31(3)23-25-35/h7-25,33H,1,26-29H2,2-6H3/t33-/m1/s1 |
| InChIKey | KPBVQGCHJRGFBV-MGBGTMOVSA-N |
| XLogP | 7.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.95 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|