C40H49NO5SSi — CID 134935012
(2S,3R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-2-(4-methylpent-3-enyl)-1-(4-methylphenyl)sulfonyl-3,4-dihydroquinolin-3-ol (PubChem CID 134935012) has the molecular formula C40H49NO5SSi and a molecular weight of 683.99 g/mol. Its IUPAC name is (2S,3R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-2-(4-methylpent-3-enyl)-1-(4-methylphenyl)sulfonyl-3,4-dihydroquinolin-3-ol.
| Compound Name | (2S,3R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-2-(4-methylpent-3-enyl)-1-(4-methylphenyl)sulfonyl-3,4-dihydroquinolin-3-ol |
|---|---|
| PubChem CID | 134935012 |
| Molecular Formula | C40H49NO5SSi |
| Molecular Weight | 683.99 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | (2S,3R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(hydroxymethyl)-2-(4-methylpent-3-enyl)-1-(4-methylphenyl)sulfonyl-3,4-dihydroquinolin-3-ol |
| SMILES | CC(C)=CCC[C@]1(CO)[C@H](O)Cc2cc(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)ccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C40H49NO5SSi/c1-30(2)14-13-25-40(29-42)38(43)27-33-26-32(21-24-37(33)41(40)47(44,45)34-22-19-31(3)20-23-34)28-46-48(39(4,5)6,35-15-9-7-10-16-35)36-17-11-8-12-18-36/h7-12,14-24,26,38,42-43H,13,25,27-29H2,1-6H3/t38-,40+/m1/s1 |
| InChIKey | STNDETAZGWWAHD-PDRJUJFWSA-N |
| XLogP | 6.66 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.99 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|