C40H44N2O4SSi — CID 53375487
(1S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[1-(4-methylphenyl)sulfonylindol-2-yl]-2-azabicyclo[3.3.1]non-2-en-1-ol (PubChem CID 53375487) has the molecular formula C40H44N2O4SSi and a molecular weight of 676.96 g/mol. Its IUPAC name is (1S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[1-(4-methylphenyl)sulfonylindol-2-yl]-2-azabicyclo[3.3.1]non-2-en-1-ol.
| Compound Name | (1S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[1-(4-methylphenyl)sulfonylindol-2-yl]-2-azabicyclo[3.3.1]non-2-en-1-ol |
|---|---|
| PubChem CID | 53375487 |
| Molecular Formula | C40H44N2O4SSi |
| Molecular Weight | 676.96 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | (1S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[1-(4-methylphenyl)sulfonylindol-2-yl]-2-azabicyclo[3.3.1]non-2-en-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C3=N[C@]4(O)CC[C@@H](CO[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)[C@H](C3)C4)cc3ccccc32)cc1 |
| InChI | InChI=1S/C40H44N2O4SSi/c1-29-19-21-33(22-20-29)47(44,45)42-37-18-12-11-13-30(37)26-38(42)36-25-32-27-40(43,41-36)24-23-31(32)28-46-48(39(2,3)4,34-14-7-5-8-15-34)35-16-9-6-10-17-35/h5-22,26,31-32,43H,23-25,27-28H2,1-4H3/t31-,32+,40-/m0/s1 |
| InChIKey | CSFVMSSEZTXEPF-WFBHGHPOSA-N |
| XLogP | 7.06 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.96 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|