C26H34O3Si — CID 134998398
(1S,2R,4S,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-ethenyl-4-methyl-8-oxabicyclo[3.2.1]octan-1-ol (PubChem CID 134998398) has the molecular formula C26H34O3Si and a molecular weight of 422.64 g/mol. Its IUPAC name is (1S,2R,4S,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-ethenyl-4-methyl-8-oxabicyclo[3.2.1]octan-1-ol.
| Compound Name | (1S,2R,4S,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-ethenyl-4-methyl-8-oxabicyclo[3.2.1]octan-1-ol |
|---|---|
| PubChem CID | 134998398 |
| Molecular Formula | C26H34O3Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (1S,2R,4S,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-ethenyl-4-methyl-8-oxabicyclo[3.2.1]octan-1-ol |
| SMILES | C=C[C@]12CC[C@](O)(O1)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H]2C |
| InChI | InChI=1S/C26H34O3Si/c1-6-25-17-18-26(27,29-25)23(19-20(25)2)28-30(24(3,4)5,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h6-16,20,23,27H,1,17-19H2,2-5H3/t20-,23+,25+,26-/m0/s1 |
| InChIKey | SSNMBEVIGPRVAY-HCBGRYSISA-N |
| XLogP | 4.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|