C21H24O5 — CID 135028000
dimethyl (1S,2R,7S,8S)-8-methyl-4-phenyl-11-oxatricyclo[6.2.1.02,7]undec-3-ene-9,9-dicarboxylate (PubChem CID 135028000) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is dimethyl (1S,2R,7S,8S)-8-methyl-4-phenyl-11-oxatricyclo[6.2.1.02,7]undec-3-ene-9,9-dicarboxylate.
| Compound Name | dimethyl (1S,2R,7S,8S)-8-methyl-4-phenyl-11-oxatricyclo[6.2.1.02,7]undec-3-ene-9,9-dicarboxylate |
|---|---|
| PubChem CID | 135028000 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | dimethyl (1S,2R,7S,8S)-8-methyl-4-phenyl-11-oxatricyclo[6.2.1.02,7]undec-3-ene-9,9-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2O[C@@]1(C)[C@H]1CCC(c3ccccc3)=C[C@@H]21 |
| InChI | InChI=1S/C21H24O5/c1-20-16-10-9-14(13-7-5-4-6-8-13)11-15(16)17(26-20)12-21(20,18(22)24-2)19(23)25-3/h4-8,11,15-17H,9-10,12H2,1-3H3/t15-,16+,17+,20+/m1/s1 |
| InChIKey | DFAQXECBXLFDOS-YLAKUSLOSA-N |
| XLogP | 2.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|