C26H36OSi — CID 135033492
tert-butyl-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]oxy-diphenylsilane (PubChem CID 135033492) has the molecular formula C26H36OSi and a molecular weight of 392.66 g/mol. Its IUPAC name is tert-butyl-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 135033492 |
| Molecular Formula | C26H36OSi |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | tert-butyl-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]oxy-diphenylsilane |
| SMILES | CC1=C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C(C)C)CC1 |
| InChI | InChI=1S/C26H36OSi/c1-20(2)24-18-17-21(3)19-25(24)27-28(26(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,19-20,24-25H,17-18H2,1-6H3/t24-,25+/m0/s1 |
| InChIKey | XBBJUIILXBYNOP-LOSJGSFVSA-N |
| XLogP | 5.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|