C18H31BCl2 — CID 135048421
[(Z)-1,4-dichlorobut-2-en-2-yl]-bis[(1S,2S)-2-methylcyclohexyl]borane (PubChem CID 135048421) has the molecular formula C18H31BCl2 and a molecular weight of 329.16 g/mol. Its IUPAC name is [(Z)-1,4-dichlorobut-2-en-2-yl]-bis[(1S,2S)-2-methylcyclohexyl]borane.
| Compound Name | [(Z)-1,4-dichlorobut-2-en-2-yl]-bis[(1S,2S)-2-methylcyclohexyl]borane |
|---|---|
| PubChem CID | 135048421 |
| Molecular Formula | C18H31BCl2 |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(Z)-1,4-dichlorobut-2-en-2-yl]-bis[(1S,2S)-2-methylcyclohexyl]borane |
| SMILES | C[C@H]1CCCC[C@@H]1B(/C(=C/CCl)CCl)[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C18H31BCl2/c1-14-7-3-5-9-17(14)19(16(13-21)11-12-20)18-10-6-4-8-15(18)2/h11,14-15,17-18H,3-10,12-13H2,1-2H3/b16-11+/t14-,15-,17-,18-/m0/s1 |
| InChIKey | PVYQAVOHZGPESB-NRBHOQJMSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|